cas: 645416-98-4 — see every product listed under this CAS number, including other names
5'-Bromospiro(cyclohexane-1,3'-indoline), 98% (CAS 645416-98-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A743650-250mg |
| cas | 645416-98-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 5994.10 Pln | |
| AmBeed | 5g | 34768.30 Pln | |
| AmBeed | 1g | 9971.71 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] (CAS 645416-98-4) is a chemical compound with the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. IUPAC name: 5-bromospiro[1,2-dihydroindole-3,1'-cyclohexane]. InChIKey: IZEPVDFSBBDDPJ-UHFFFAOYSA-N.
| Molecular formula | C13H16BrN |
|---|---|
| Molecular weight | 266.18 g/mol |
| IUPAC name | 5-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] |
| InChIKey | IZEPVDFSBBDDPJ-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CNC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)