CAS 2143028-71-9 is the registry number for 4-Bromo-3,5-diisopropylbenzonitrile, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
4-bromo-3,5-di(propan-2-yl)benzonitrile (CAS 2143028-71-9) is a chemical compound with the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. IUPAC name: 4-bromo-3,5-di(propan-2-yl)benzonitrile. InChIKey: GYNNAVXZGKBKLD-UHFFFAOYSA-N.
| Molecular formula | C13H16BrN |
|---|---|
| Molecular weight | 266.18 g/mol |
| IUPAC name | 4-bromo-3,5-di(propan-2-yl)benzonitrile |
| InChIKey | GYNNAVXZGKBKLD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1Br)C(C)C)C#N |
Computed by PubChem (NCBI)