CAS 645416-98-4 appears in our catalog under these names: 5'-Bromospiro(cyclohexane-1,3'-indoline), 98%, 5'-Bromo-1',2'-dihydrospiro[cyclohexane-1,3'-indole], 95%, 5–Bromo–1,2–Dihydrospiro(Cyclohexane–1,3–Indole). Offered by: AmBeed, Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
5-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] (CAS 645416-98-4) is a chemical compound with the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. IUPAC name: 5-bromospiro[1,2-dihydroindole-3,1'-cyclohexane]. InChIKey: IZEPVDFSBBDDPJ-UHFFFAOYSA-N.
| Molecular formula | C13H16BrN |
|---|---|
| Molecular weight | 266.18 g/mol |
| IUPAC name | 5-bromospiro[1,2-dihydroindole-3,1'-cyclohexane] |
| InChIKey | IZEPVDFSBBDDPJ-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CNC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)