5,10-Dihydroindolo[3,2-b]indole, 97%
cas: 3682-85-7 — see every product listed under this CAS number, including other names
5,10-Dihydroindolo[3,2-b]indole, 97% (CAS 3682-85-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A709219-250mg |
| cas | 3682-85-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 876.56 Pln | |
| Ambeed | 5g | 2884.62 Pln | |
| BLDpharm | 100mg | 225.50 Pln | |
| BLDpharm | 250mg | 425.43 Pln | |
| BLDpharm | 1g | 936.36 Pln | |
| BLDpharm | 5g | 3107.82 Pln | |
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 888.25 Pln | |
| Fluorochem | 5g | 2851.10 Pln | |
| Fluorochem | 10g | 5428.31 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5,10-dihydroindolo[3,2-b]indole (CAS 3682-85-7) is a chemical compound with the molecular formula C14H10N2 and a molecular weight of 206.24 g/mol. IUPAC name: 5,10-dihydroindolo[3,2-b]indole. InChIKey: XELZZMRNRUUICC-UHFFFAOYSA-N.
| Molecular formula | C14H10N2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 5,10-dihydroindolo[3,2-b]indole |
| InChIKey | XELZZMRNRUUICC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=CC=CC=C4N3 |
Computed by PubChem (NCBI)