CAS 3682-85-7 appears in our catalog under these names: 5,10-Dihydroindolo[3,2-b]indole, 95%, 5,10-Dihydroindolo[3,2-b]indole 97%, 5,10-Dihydroindolo[3,2-b]indole, 98%, 98%, 5,10-Dihydroindolo[3,2-b]indole, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
5,10-dihydroindolo[3,2-b]indole (CAS 3682-85-7) is a chemical compound with the molecular formula C14H10N2 and a molecular weight of 206.24 g/mol. IUPAC name: 5,10-dihydroindolo[3,2-b]indole. InChIKey: XELZZMRNRUUICC-UHFFFAOYSA-N.
| Molecular formula | C14H10N2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 5,10-dihydroindolo[3,2-b]indole |
| InChIKey | XELZZMRNRUUICC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=CC=CC=C4N3 |
Computed by PubChem (NCBI)