CAS 4949-02-4 is the registry number for 2,2'-(Naphthalene-2,6-diyl)diacetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[6-(cyanomethyl)naphthalen-2-yl]acetonitrile (CAS 4949-02-4) is a chemical compound with the molecular formula C14H10N2 and a molecular weight of 206.24 g/mol. IUPAC name: 2-[6-(cyanomethyl)naphthalen-2-yl]acetonitrile. InChIKey: RZWVWBONNSEWDU-UHFFFAOYSA-N.
| Molecular formula | C14H10N2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-[6-(cyanomethyl)naphthalen-2-yl]acetonitrile |
| InChIKey | RZWVWBONNSEWDU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CC#N)C=C1CC#N |
Computed by PubChem (NCBI)