CAS 501374-30-7 appears in our catalog under these names: 4–trifluoromethylbenzeneboronic acid neopentyl glycol ester, 5,5-Dimethyl-2-(4-(trifluoromethyl)phenyl)-1,3,2-dioxaborinane, 98%, 98%, 1,3,2-Dioxaborinane, 5,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-, 98%, 5,5-Dimethyl-2-(4-(trifluoromethyl)phenyl)-1,3,2-dioxaborinane, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 25g, 100g.
5,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane (CAS 501374-30-7) is a chemical compound with the molecular formula C12H14BF3O2 and a molecular weight of 258.05 g/mol. IUPAC name: 5,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane. InChIKey: RHRLRPXJTDDILM-UHFFFAOYSA-N.
| Molecular formula | C12H14BF3O2 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5,5-dimethyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane |
| InChIKey | RHRLRPXJTDDILM-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)