Products 95753-22-3
CAS 95753-22-3 appears in our catalog under these names: 5，5–dimethyl–2–(2–(trifluoromethyl)phenyl)–1，3，2–dioxaborinane, 5,5-Dimethyl-2-(2-(trifluoromethyl)phenyl)-1,3,2-dioxaborinane, 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 5g.
5,5-dimethyl-2-[2-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane (CAS 95753-22-3) is a chemical compound with the molecular formula C12H14BF3O2 and a molecular weight of 258.05 g/mol. IUPAC name: 5,5-dimethyl-2-[2-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane. InChIKey: FWYOUBPQXPFVOP-UHFFFAOYSA-N.
| Molecular formula | C12H14BF3O2 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5,5-dimethyl-2-[2-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane |
| InChIKey | FWYOUBPQXPFVOP-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)