CAS 635305-32-7 is the registry number for 5,5–dimethyl–2–(3–(trifluoromethyl)phenyl)–1,3,2–dioxaborinane. Offered by: GLPBio. Available pack sizes: 1g, 5g.
5,5-dimethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane (CAS 635305-32-7) is a chemical compound with the molecular formula C12H14BF3O2 and a molecular weight of 258.05 g/mol. IUPAC name: 5,5-dimethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane. InChIKey: LXGDSRYKYFVNCZ-UHFFFAOYSA-N.
| Molecular formula | C12H14BF3O2 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5,5-dimethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborinane |
| InChIKey | LXGDSRYKYFVNCZ-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)