cas: 502622-85-7 — see every product listed under this CAS number, including other names
5,5-Dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane 95% (CAS 502622-85-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A477299-250mg |
| cas | 502622-85-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 720.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A477299 |
5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane (CAS 502622-85-7) is a chemical compound with the molecular formula C11H14BNO4 and a molecular weight of 235.05 g/mol. IUPAC name: 5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane. InChIKey: RRGGUJKPJNSZFX-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO4 |
|---|---|
| Molecular weight | 235.05 g/mol |
| IUPAC name | 5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane |
| InChIKey | RRGGUJKPJNSZFX-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)