Products 1416371-19-1

CAS 1416371-19-1 appears in our catalog under these names: 9–Phenanthreneboronic acid neopentylglycol ester, 5,5-Dimethyl-2-(phenanthren-9-yl)-1,3,2-dioxaborinane, 97%, 97%, 5,5-Dimethyl-2-(phenanthren-9-yl)-1,3,2-dioxaborinane, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g.

Structural formula: {0} (CAS {1})

5,5-dimethyl-2-phenanthren-9-yl-1,3,2-dioxaborinane (CAS 1416371-19-1) is a chemical compound with the molecular formula C19H19BO2 and a molecular weight of 290.2 g/mol. IUPAC name: 5,5-dimethyl-2-phenanthren-9-yl-1,3,2-dioxaborinane. InChIKey: WZXSJDKNWAQBOL-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19BO2
Molecular weight290.2 g/mol
IUPAC name5,5-dimethyl-2-phenanthren-9-yl-1,3,2-dioxaborinane
InChIKeyWZXSJDKNWAQBOL-UHFFFAOYSA-N
SMILESB1(OCC(CO1)(C)C)C2=CC3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)