CAS 1416371-19-1 appears in our catalog under these names: 9–Phenanthreneboronic acid neopentylglycol ester, 5,5-Dimethyl-2-(phenanthren-9-yl)-1,3,2-dioxaborinane, 97%, 97%, 5,5-Dimethyl-2-(phenanthren-9-yl)-1,3,2-dioxaborinane, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g.
5,5-dimethyl-2-phenanthren-9-yl-1,3,2-dioxaborinane (CAS 1416371-19-1) is a chemical compound with the molecular formula C19H19BO2 and a molecular weight of 290.2 g/mol. IUPAC name: 5,5-dimethyl-2-phenanthren-9-yl-1,3,2-dioxaborinane. InChIKey: WZXSJDKNWAQBOL-UHFFFAOYSA-N.
| Molecular formula | C19H19BO2 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | 5,5-dimethyl-2-phenanthren-9-yl-1,3,2-dioxaborinane |
| InChIKey | WZXSJDKNWAQBOL-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)