CAS 1034330-14-7 is the registry number for 4–(phenylethynyl)phenylboronic acid neopentyl glycol ester. Offered by: GLPBio. Available pack sizes: 1g, 25g, 5g.
5,5-dimethyl-2-[4-(2-phenylethynyl)phenyl]-1,3,2-dioxaborinane (CAS 1034330-14-7) is a chemical compound with the molecular formula C19H19BO2 and a molecular weight of 290.2 g/mol. IUPAC name: 5,5-dimethyl-2-[4-(2-phenylethynyl)phenyl]-1,3,2-dioxaborinane. InChIKey: UNNLAYAZASQVFT-UHFFFAOYSA-N.
| Molecular formula | C19H19BO2 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | 5,5-dimethyl-2-[4-(2-phenylethynyl)phenyl]-1,3,2-dioxaborinane |
| InChIKey | UNNLAYAZASQVFT-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C#CC3=CC=CC=C3 |
Computed by PubChem (NCBI)