cas: 355408-55-8 — see every product listed under this CAS number, including other names
5,5-Dimethyl-2-(thiophen-2-yl)-1,3,2-dioxaborinane 98% (CAS 355408-55-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A286230-1g |
| cas | 355408-55-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 25g | 770.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A286230 |
5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane (CAS 355408-55-8) is a chemical compound with the molecular formula C9H13BO2S and a molecular weight of 196.08 g/mol. IUPAC name: 5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane. InChIKey: OQCFQKMFRXSPPP-UHFFFAOYSA-N.
| Molecular formula | C9H13BO2S |
|---|---|
| Molecular weight | 196.08 g/mol |
| IUPAC name | 5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane |
| InChIKey | OQCFQKMFRXSPPP-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CS2 |
Computed by PubChem (NCBI)