Products 355408-55-8
CAS 355408-55-8 appears in our catalog under these names: Thiophene-2-boronic acid, neopentyl glycol ester, 98%, 5，5–Dimethyl–2–(thiophen–2–yl)–1，3，2–dioxaborinane, 5,5-Dimethyl-2-(thiophen-2-yl)-1,3,2-dioxaborinane 98%, Thiophene-2-boronic acid, neopentyl glycol ester, 98%, 98%, 5,5-Dimethyl-2-(thiophen-2-yl)-1,3,2-dioxaborinane, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane (CAS 355408-55-8) is a chemical compound with the molecular formula C9H13BO2S and a molecular weight of 196.08 g/mol. IUPAC name: 5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane. InChIKey: OQCFQKMFRXSPPP-UHFFFAOYSA-N.
| Molecular formula | C9H13BO2S |
|---|---|
| Molecular weight | 196.08 g/mol |
| IUPAC name | 5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane |
| InChIKey | OQCFQKMFRXSPPP-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CS2 |
Computed by PubChem (NCBI)
Synonyms:
Thiophene-2-boronic acid, neopentyl glycol ester, 5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane, 5,5-dimethyl-2-(2-thienyl)-1,3,2-dioxaborinane, orb3021440, 2-Thiopheneboronic acid neopentyl glycol ester, Thiophene-2-boronic acid,neopentyl glycol ester, 1,3,2-Dioxaborinane, 5,5-dimethyl-2-(2-thienyl)-