cas: 355408-55-8 — see every product listed under this CAS number, including other names
5,5-Dimethyl-2-(thiophen-2-yl)-1,3,2-dioxaborinane, 98% (CAS 355408-55-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694227-250MG |
| cas | 355408-55-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 284.29 Pln | |
| Fluorochem | 25g | 1028.82 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane (CAS 355408-55-8) is a chemical compound with the molecular formula C9H13BO2S and a molecular weight of 196.08 g/mol. IUPAC name: 5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane. InChIKey: OQCFQKMFRXSPPP-UHFFFAOYSA-N.
| Molecular formula | C9H13BO2S |
|---|---|
| Molecular weight | 196.08 g/mol |
| IUPAC name | 5,5-dimethyl-2-thiophen-2-yl-1,3,2-dioxaborinane |
| InChIKey | OQCFQKMFRXSPPP-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CS2 |
Computed by PubChem (NCBI)