5,5-Dimethyl-2-propanoylcyclohexane-1,3-dione, 95%
cas: 1904-20-7 — see every product listed under this CAS number, including other names
5,5-Dimethyl-2-propanoylcyclohexane-1,3-dione, 95% (CAS 1904-20-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1019488-250mg |
| cas | 1904-20-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1499.56 Pln | |
| Ambeed | 5g | 4219.62 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1384.40 Pln | |
| Chemat | 5g | 3894.80 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1452.85 Pln | |
| BLDpharm | 5g | 4057.48 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5,5-dimethyl-2-propanoylcyclohexane-1,3-dione (CAS 1904-20-7) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: 5,5-dimethyl-2-propanoylcyclohexane-1,3-dione. InChIKey: SQARRWJOVCLAKY-UHFFFAOYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 5,5-dimethyl-2-propanoylcyclohexane-1,3-dione |
| InChIKey | SQARRWJOVCLAKY-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1C(=O)CC(CC1=O)(C)C |
Computed by PubChem (NCBI)