CAS 1904-20-7 appears in our catalog under these names: 5,5-Dimethyl-2-propanoylcyclohexane-1,3-dione, 95%, 95%, 5,5-Dimethyl-2-propanoylcyclohexane-1,3-dione, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
5,5-dimethyl-2-propanoylcyclohexane-1,3-dione (CAS 1904-20-7) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: 5,5-dimethyl-2-propanoylcyclohexane-1,3-dione. InChIKey: SQARRWJOVCLAKY-UHFFFAOYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 5,5-dimethyl-2-propanoylcyclohexane-1,3-dione |
| InChIKey | SQARRWJOVCLAKY-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1C(=O)CC(CC1=O)(C)C |
Computed by PubChem (NCBI)