cas: 1187929-87-8 — see every product listed under this CAS number, including other names
5,6,7,8-TETRAHYDROQUINOLIN-8-AMINE 2HCL, 95% (CAS 1187929-87-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F302584-250MG |
| cas | 1187929-87-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 539.41 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride (CAS 1187929-87-8) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride. InChIKey: DTETYNWEDVEEFT-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 5,6,7,8-tetrahydroquinolin-8-amine;dihydrochloride |
| InChIKey | DTETYNWEDVEEFT-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)