cas: 22824-31-3 — see every product listed under this CAS number, including other names
5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthalenol, 98%, 98% (CAS 22824-31-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BGPB-100mg |
| cas | 22824-31-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 539.60 Pln | |
| Chemat | 5g | 1499.60 Pln | |
| Chemat | 500mg | 352.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol (CAS 22824-31-3) is a chemical compound with the molecular formula C14H20O and a molecular weight of 204.31 g/mol. IUPAC name: 5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol. InChIKey: UZHCJGSIRIFQTO-UHFFFAOYSA-N.
| Molecular formula | C14H20O |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | 5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol |
| InChIKey | UZHCJGSIRIFQTO-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)O)(C)C)C |
Computed by PubChem (NCBI)