CAS 1785764-26-2 appears in our catalog under these names: 5,6–Diamino–1,3–diethyluracil Hydrochloride, 5,6-Diamino-1,3-diethyluracil Hydrochloride, >98.0%(HPLC)(T), 5,6-Diamino-1,3-diethyluracil Hydrochloride, 98.0%, 98.0%, 5,6-Diamino-1,3-diethylpyrimidine-2,4(1H,3H)-dione hydrochloride, 95%, 5,6-Diamino-1,3-diethylpyrimidine-2,4(1H,3H)-dione hydrochloride, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
5,6-diamino-1,3-diethylpyrimidine-2,4-dione;hydrochloride (CAS 1785764-26-2) is a chemical compound with the molecular formula C8H15ClN4O2 and a molecular weight of 234.68 g/mol. IUPAC name: 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;hydrochloride. InChIKey: UQWLJOFXKBZWCI-UHFFFAOYSA-N.
| Molecular formula | C8H15ClN4O2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;hydrochloride |
| InChIKey | UQWLJOFXKBZWCI-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=O)N(C1=O)CC)N)N.Cl |
Computed by PubChem (NCBI)