Products 1432033-49-2
CAS 1432033-49-2 is the registry number for 3-(3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)propan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-1-amine;hydrochloride (CAS 1432033-49-2) is a chemical compound with the molecular formula C8H15ClN4O2 and a molecular weight of 234.68 g/mol. IUPAC name: 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-1-amine;hydrochloride. InChIKey: VYRRBOPSSDQYDW-UHFFFAOYSA-N.
| Molecular formula | C8H15ClN4O2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-1-amine;hydrochloride |
| InChIKey | VYRRBOPSSDQYDW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCCN)C)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)