Products 1808408-70-9
CAS 1808408-70-9 is the registry number for (1-((3R,4S)-4-Methoxytetrahydrofuran-3-yl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine;hydrochloride (CAS 1808408-70-9) is a chemical compound with the molecular formula C8H15ClN4O2 and a molecular weight of 234.68 g/mol. IUPAC name: [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine;hydrochloride. InChIKey: GZKHUGMCOGXOIQ-SCLLHFNJSA-N.
| Molecular formula | C8H15ClN4O2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine;hydrochloride |
| InChIKey | GZKHUGMCOGXOIQ-SCLLHFNJSA-N |
| SMILES | CO[C@@H]1COC[C@H]1N2C=C(N=N2)CN.Cl |
Computed by PubChem (NCBI)