cas: 15997-89-4 — see every product listed under this CAS number, including other names
5,6-Dichloroisoindoline-1,3-dione 98% (CAS 15997-89-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A772670-250mg |
| cas | 15997-89-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A772670 |
5,6-dichloroisoindole-1,3-dione (CAS 15997-89-4) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 5,6-dichloroisoindole-1,3-dione. InChIKey: QJPBDGMPYPSJSF-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 5,6-dichloroisoindole-1,3-dione |
| InChIKey | QJPBDGMPYPSJSF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)C(=O)NC2=O |
Computed by PubChem (NCBI)