Products 18711-12-1
CAS 18711-12-1 appears in our catalog under these names: 6,7-Dichloro-1h-indole-2,3-dione, 95%, 6,7-Dichloroindoline-2,3-dione, 95%, 95%, 6,7-dichloro-1H-indole-2,3-dione. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
6,7-dichloro-1H-indole-2,3-dione (CAS 18711-12-1) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 6,7-dichloro-1H-indole-2,3-dione. InChIKey: XTXIILHWOQZVAQ-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 6,7-dichloro-1H-indole-2,3-dione |
| InChIKey | XTXIILHWOQZVAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
6,7-dichloro-1H-indole-2,3-dione, 6,7-dichloroisatin, 1H-Indole-2,3-dione, 6,7-dichloro-, 6,7-dichloro-2,3-dihydro-1H-indole-2,3-dione, 6,7-Bis(chloranyl)-1H-indole-2,3-dione, 6,7-Dichloroindoline-2,3-dione, 6,7-dichlorisatin, 1H-Indole-2,3-dione,6,7-dichloro-, Isatin-based compound, 54, XTXIILHWOQZVAQ-UHFFFAOYSA-N