Products 1807162-56-6
CAS 1807162-56-6 appears in our catalog under these names: 3-Cyano-2,4-dichlorobenzoic acid, 97%, 3-Cyano-2,4-dichlorobenzoicacid, ≥95%, ≥95%, 3-Cyano-2,4-dichlorobenzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
2,4-dichloro-3-cyanobenzoic acid (CAS 1807162-56-6) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 2,4-dichloro-3-cyanobenzoic acid. InChIKey: MHXAKISAXHNZEE-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 2,4-dichloro-3-cyanobenzoic acid |
| InChIKey | MHXAKISAXHNZEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)C#N)Cl |
Computed by PubChem (NCBI)