cas: 74004-74-3 — see every product listed under this CAS number, including other names
5,6-Dimethoxy-1H-benzo[d]imidazole-2-thiol 95% (CAS 74004-74-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A819916-100mg |
| cas | 74004-74-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 559.50 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1538.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A819916 |
5,6-dimethoxy-1,3-dihydrobenzimidazole-2-thione (CAS 74004-74-3) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 5,6-dimethoxy-1,3-dihydrobenzimidazole-2-thione. InChIKey: AIPIIYXJGWHOHR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 5,6-dimethoxy-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | AIPIIYXJGWHOHR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NC(=S)N2)OC |
Computed by PubChem (NCBI)