cas: 4136-26-9 — see every product listed under this CAS number, including other names
5,6-Dimethoxy-3,3-dimethyl-2,3-dihydro-1H-inden-1-one, 96%, 96% (CAS 4136-26-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CAQY-100mg |
| cas | 4136-26-9 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 635.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5,6-dimethoxy-3,3-dimethyl-2H-inden-1-one (CAS 4136-26-9) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 5,6-dimethoxy-3,3-dimethyl-2H-inden-1-one. InChIKey: KYEDLQFODOWDRO-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 5,6-dimethoxy-3,3-dimethyl-2H-inden-1-one |
| InChIKey | KYEDLQFODOWDRO-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=CC(=C(C=C21)OC)OC)C |
Computed by PubChem (NCBI)