cas: 23046-03-9 — see every product listed under this CAS number, including other names
5,6-Dimethoxybenzo[b]thiophene-2-carboxylic acid, 97%, 97% (CAS 23046-03-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113LZF-100mg |
| cas | 23046-03-9 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 1994.00 Pln | |
| Chemat | 100g | 3645.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,6-dimethoxy-1-benzothiophene-2-carboxylic acid (CAS 23046-03-9) is a chemical compound with the molecular formula C11H10O4S and a molecular weight of 238.26 g/mol. IUPAC name: 5,6-dimethoxy-1-benzothiophene-2-carboxylic acid. InChIKey: LIZUZUKHOVUSNS-UHFFFAOYSA-N.
| Molecular formula | C11H10O4S |
|---|---|
| Molecular weight | 238.26 g/mol |
| IUPAC name | 5,6-dimethoxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | LIZUZUKHOVUSNS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(S2)C(=O)O)OC |
Computed by PubChem (NCBI)