Products 23046-03-9

CAS 23046-03-9 appears in our catalog under these names: 5,6-Dimethoxybenzo[b]thiophene-2-carboxylic acid, 97%, 97%, 5,6-Dimethoxybenzo[b]thiophene-2-carboxylic acid, 96%, 5,6-Dimethoxybenzo[b]thiophene-2-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

5,6-dimethoxy-1-benzothiophene-2-carboxylic acid (CAS 23046-03-9) is a chemical compound with the molecular formula C11H10O4S and a molecular weight of 238.26 g/mol. IUPAC name: 5,6-dimethoxy-1-benzothiophene-2-carboxylic acid. InChIKey: LIZUZUKHOVUSNS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O4S
Molecular weight238.26 g/mol
IUPAC name5,6-dimethoxy-1-benzothiophene-2-carboxylic acid
InChIKeyLIZUZUKHOVUSNS-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C(=C1)C=C(S2)C(=O)O)OC

Computed by PubChem (NCBI)