Products 15875-50-0
CAS 15875-50-0 is the registry number for 2,2-dimethyl-5-(2-thienylmethylene)-1,3-dioxane-4,6-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2,2-dimethyl-5-(thiophen-2-ylmethylidene)-1,3-dioxane-4,6-dione (CAS 15875-50-0) is a chemical compound with the molecular formula C11H10O4S and a molecular weight of 238.26 g/mol. IUPAC name: 2,2-dimethyl-5-(thiophen-2-ylmethylidene)-1,3-dioxane-4,6-dione. InChIKey: NUWFXIJTIAJXML-UHFFFAOYSA-N.
| Molecular formula | C11H10O4S |
|---|---|
| Molecular weight | 238.26 g/mol |
| IUPAC name | 2,2-dimethyl-5-(thiophen-2-ylmethylidene)-1,3-dioxane-4,6-dione |
| InChIKey | NUWFXIJTIAJXML-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CC2=CC=CS2)C(=O)O1)C |
Computed by PubChem (NCBI)