5,6-Isopropylidene-L-gulonic acid γ-lactone
cas: 94697-68-4 — see every product listed under this CAS number, including other names
5,6-Isopropylidene-L-gulonic acid γ-lactone (CAS 94697-68-4) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 100 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W077275-5 g |
| cas | 94697-68-4 |
| size | 5 g |
| availability | Get quote |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 3621.58 Pln | |
| MedChemExpress | 100 mg | 514.74 Pln | |
| MedChemExpress | 1 g | 1304.22 Pln |
properties
| delivery time | over 3 weeks |
|---|---|
| purity | no data |
(3S,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one (CAS 94697-68-4) is a chemical compound with the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. IUPAC name: (3S,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one. InChIKey: JNTPPVKRHGNFKM-BNHYGAARSA-N.
| Molecular formula | C9H14O6 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (3S,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one |
| InChIKey | JNTPPVKRHGNFKM-BNHYGAARSA-N |
| SMILES | CC1(OC[C@H](O1)[C@@H]2[C@@H]([C@@H](C(=O)O2)O)O)C |
Computed by PubChem (NCBI)