cas: 204394-52-5 — see every product listed under this CAS number, including other names
5,6-dimethyl-2-(pyridin-2-yl)-1,4-dihydropyrimidin-4-one, 95% (CAS 204394-52-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F670566-250MG |
| cas | 204394-52-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 987.17 Pln | |
| Fluorochem | 1g | 1924.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4,5-dimethyl-2-pyridin-2-yl-1H-pyrimidin-6-one (CAS 204394-52-5) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 4,5-dimethyl-2-pyridin-2-yl-1H-pyrimidin-6-one. InChIKey: RVSHHTOLEDONMB-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 4,5-dimethyl-2-pyridin-2-yl-1H-pyrimidin-6-one |
| InChIKey | RVSHHTOLEDONMB-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(NC1=O)C2=CC=CC=N2)C |
Computed by PubChem (NCBI)