cas: 50477-28-6 — see every product listed under this CAS number, including other names
5,7-Dibromo-1H-indazole, 95%+, 95%+ (CAS 50477-28-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117YMC-50mg |
| cas | 50477-28-6 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 160.40 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1283.60 Pln | |
| Chemat | 10g | 1686.80 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
5,7-dibromo-1H-indazole (CAS 50477-28-6) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 5,7-dibromo-1H-indazole. InChIKey: SBDPXXDRYPLLKE-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 5,7-dibromo-1H-indazole |
| InChIKey | SBDPXXDRYPLLKE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C=NN2)Br)Br |
Computed by PubChem (NCBI)