cas: 17012-49-6 — see every product listed under this CAS number, including other names
5,7-Dibromo-8-methoxyquinoline, 98%, 98% (CAS 17012-49-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AAZA-100mg |
| cas | 17012-49-6 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 827.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,7-dibromo-8-methoxyquinoline (CAS 17012-49-6) is a chemical compound with the molecular formula C10H7Br2NO and a molecular weight of 316.98 g/mol. IUPAC name: 5,7-dibromo-8-methoxyquinoline. InChIKey: IJANXCJVULGZRF-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO |
|---|---|
| Molecular weight | 316.98 g/mol |
| IUPAC name | 5,7-dibromo-8-methoxyquinoline |
| InChIKey | IJANXCJVULGZRF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C2=C1N=CC=C2)Br)Br |
Computed by PubChem (NCBI)