CAS 23974-11-0 appears in our catalog under these names: 3-Bromo-4-(bromomethyl)quinolin-2(1H)-one, 98%, Ruibapaite Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4-(bromomethyl)-1H-quinolin-2-one (CAS 23974-11-0) is a chemical compound with the molecular formula C10H7Br2NO and a molecular weight of 316.98 g/mol. IUPAC name: 3-bromo-4-(bromomethyl)-1H-quinolin-2-one. InChIKey: HJUBOIGEQMRBNA-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO |
|---|---|
| Molecular weight | 316.98 g/mol |
| IUPAC name | 3-bromo-4-(bromomethyl)-1H-quinolin-2-one |
| InChIKey | HJUBOIGEQMRBNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)N2)Br)CBr |
Computed by PubChem (NCBI)