CAS 1187386-37-3 is the registry number for 5,8-Dibromo-6-methoxyquinoline, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
5,8-dibromo-6-methoxyquinoline (CAS 1187386-37-3) is a chemical compound with the molecular formula C10H7Br2NO and a molecular weight of 316.98 g/mol. IUPAC name: 5,8-dibromo-6-methoxyquinoline. InChIKey: WMNDQHFHVXYHJT-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2NO |
|---|---|
| Molecular weight | 316.98 g/mol |
| IUPAC name | 5,8-dibromo-6-methoxyquinoline |
| InChIKey | WMNDQHFHVXYHJT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1Br)C=CC=N2)Br |
Computed by PubChem (NCBI)