cas: 1823930-41-1 — see every product listed under this CAS number, including other names
5,7-Dichloro-1-methyl-1H-imidazo[4,5-b]pyridine (CAS 1823930-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F454076-100MG |
| cas | 1823930-41-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1445.34 Pln | |
| Fluorochem | 250mg | 2361.69 Pln |
| delivery time | 3-4 weeks |
|---|
5,7-dichloro-1-methylimidazo[4,5-b]pyridine (CAS 1823930-41-1) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 5,7-dichloro-1-methylimidazo[4,5-b]pyridine. InChIKey: ZDRSANSMVFLCEO-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 5,7-dichloro-1-methylimidazo[4,5-b]pyridine |
| InChIKey | ZDRSANSMVFLCEO-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)