cas: 57473-32-2 — see every product listed under this CAS number, including other names
5,7-Dichloroimidazo[1,2-a]pyrimidine 97% (CAS 57473-32-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A167268-100mg |
| cas | 57473-32-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 1249.25 Pln | |
| Ambeed | 5g | 4152.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A167268 |
5,7-dichloroimidazo[1,2-a]pyrimidine (CAS 57473-32-2) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 5,7-dichloroimidazo[1,2-a]pyrimidine. InChIKey: WMHORUUVAKBDSV-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 5,7-dichloroimidazo[1,2-a]pyrimidine |
| InChIKey | WMHORUUVAKBDSV-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CC(=NC2=N1)Cl)Cl |
Computed by PubChem (NCBI)