cas: 57489-77-7 — see every product listed under this CAS number, including other names
5,7-Dichloropyrazolo[1,5-a]pyrimidine 97% (CAS 57489-77-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A171329-500g |
| cas | 57489-77-7 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 8430.44 Pln | |
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 342.56 Pln | |
| Ambeed | 25g | 659.62 Pln | |
| Ambeed | 100g | 2161.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A171329 |
5,7-dichloropyrazolo[1,5-a]pyrimidine (CAS 57489-77-7) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 5,7-dichloropyrazolo[1,5-a]pyrimidine. InChIKey: JMTFWCYVZOFHLR-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 5,7-dichloropyrazolo[1,5-a]pyrimidine |
| InChIKey | JMTFWCYVZOFHLR-UHFFFAOYSA-N |
| SMILES | C1=C2N=C(C=C(N2N=C1)Cl)Cl |
Computed by PubChem (NCBI)