cas: 203626-56-6 — see every product listed under this CAS number, including other names
5,7-Dimethyl-4-hydroxyquinoline, 96%, 96% (CAS 203626-56-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11302M-100mg |
| cas | 203626-56-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 1g | 981.20 Pln | |
| Chemat | 5g | 2445.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5,7-dimethyl-1H-quinolin-4-one (CAS 203626-56-6) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 5,7-dimethyl-1H-quinolin-4-one. InChIKey: HTNWWTAMEUZKJJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 5,7-dimethyl-1H-quinolin-4-one |
| InChIKey | HTNWWTAMEUZKJJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=O)C=CNC2=C1)C |
Computed by PubChem (NCBI)