cas: 203626-56-6 — see every product listed under this CAS number, including other names
5,7-dimethyl-1,4-dihydroquinolin-4-one, 96% (CAS 203626-56-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F637714-100MG |
| cas | 203626-56-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 815.36 Pln | |
| Fluorochem | 5g | 2132.60 Pln | |
| Fluorochem | 10g | 3637.28 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5,7-dimethyl-1H-quinolin-4-one (CAS 203626-56-6) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 5,7-dimethyl-1H-quinolin-4-one. InChIKey: HTNWWTAMEUZKJJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 5,7-dimethyl-1H-quinolin-4-one |
| InChIKey | HTNWWTAMEUZKJJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=O)C=CNC2=C1)C |
Computed by PubChem (NCBI)