cas: 203626-56-6 — see every product listed under this CAS number, including other names
5,7-Dimethylquinolin-4-ol, 96% (CAS 203626-56-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A447321-5g |
| cas | 203626-56-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 3416.14 Pln | |
| AmBeed | 100mg | 577.78 Pln | |
| AmBeed | 10g | 5824.84 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,7-dimethyl-1H-quinolin-4-one (CAS 203626-56-6) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 5,7-dimethyl-1H-quinolin-4-one. InChIKey: HTNWWTAMEUZKJJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 5,7-dimethyl-1H-quinolin-4-one |
| InChIKey | HTNWWTAMEUZKJJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=O)C=CNC2=C1)C |
Computed by PubChem (NCBI)