cas: 331242-61-6 — see every product listed under this CAS number, including other names
5,8,11,14,17-Pentaoxa-2-azanonadecanoic acid, 19-hydroxy-, 1,1-dimethylethyl ester, 97%, 97% (CAS 331242-61-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CNH8-100mg |
| cas | 331242-61-6 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 990.80 Pln | |
| Chemat | 25g | 2061.20 Pln | |
| Chemat | 50g | 3438.80 Pln | |
| Chemat | 100g | 5229.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 331242-61-6) is a chemical compound with the molecular formula C17H35NO8 and a molecular weight of 381.5 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: JJZYGSPDXUBTNO-UHFFFAOYSA-N.
| Molecular formula | C17H35NO8 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | JJZYGSPDXUBTNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)