cas: 331242-61-6 — see every product listed under this CAS number, including other names
BOC-NH-PEG6-OH, 97% (CAS 331242-61-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533425-100MG |
| cas | 331242-61-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1268.32 Pln | |
| Fluorochem | 10g | 2450.20 Pln | |
| Fluorochem | 25g | 5808.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 331242-61-6) is a chemical compound with the molecular formula C17H35NO8 and a molecular weight of 381.5 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: JJZYGSPDXUBTNO-UHFFFAOYSA-N.
| Molecular formula | C17H35NO8 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | JJZYGSPDXUBTNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)