N-Boc-PEG6-alcohol, 99.73%
cas: 331242-61-6 — see every product listed under this CAS number, including other names
N-Boc-PEG6-alcohol, 99.73% (CAS 331242-61-6) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 100 mg, 250 mg, 1 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W071584-5 g |
| cas | 331242-61-6 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1726.82 Pln | |
| MedChemExpress | 100 mg | 324.34 Pln | |
| MedChemExpress | 250 mg | 380.06 Pln | |
| MedChemExpress | 1 g | 528.67 Pln | |
| MedChemExpress | 25 g | 7917.28 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.73% |
Tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 331242-61-6) is a chemical compound with the molecular formula C17H35NO8 and a molecular weight of 381.5 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: JJZYGSPDXUBTNO-UHFFFAOYSA-N.
| Molecular formula | C17H35NO8 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | JJZYGSPDXUBTNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)