cas: 172152-53-3 — see every product listed under this CAS number, including other names
5-(1H-Pyrrol-1-yl)-1H-benzo[d]imidazole-2-thiol 95% (CAS 172152-53-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156477-5g |
| cas | 172152-53-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 426.00 Pln | |
| Ambeed | 100g | 1232.56 Pln | |
| Ambeed | 500g | 4720.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156477 |
5-pyrrol-1-yl-1,3-dihydrobenzimidazole-2-thione (CAS 172152-53-3) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 5-pyrrol-1-yl-1,3-dihydrobenzimidazole-2-thione. InChIKey: YYXGYVYKGRUILQ-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 5-pyrrol-1-yl-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | YYXGYVYKGRUILQ-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC3=C(C=C2)NC(=S)N3 |
Computed by PubChem (NCBI)