cas: 172152-53-3 — see every product listed under this CAS number, including other names
1,3-dihydro-5-(1H-pyrrol-1-yl)-2H-Benzimidazole-2-thione, 95%, 95% (CAS 172152-53-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APU7-5g |
| cas | 172152-53-3 |
| size | 5g |
| availability | 602.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 136.40 Pln | |
| Chemat | 25g | 309.20 Pln | |
| Chemat | 100g | 837.20 Pln | |
| Chemat | 500g | 3072.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-pyrrol-1-yl-1,3-dihydrobenzimidazole-2-thione (CAS 172152-53-3) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 5-pyrrol-1-yl-1,3-dihydrobenzimidazole-2-thione. InChIKey: YYXGYVYKGRUILQ-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 5-pyrrol-1-yl-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | YYXGYVYKGRUILQ-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC3=C(C=C2)NC(=S)N3 |
Computed by PubChem (NCBI)