CAS 40477-31-4 is the registry number for 5-(1H-Indol-3-yl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(1H-indol-3-yl)-1,3-thiazol-2-amine (CAS 40477-31-4) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: 5-(1H-indol-3-yl)-1,3-thiazol-2-amine. InChIKey: LNABUUAHFCFGIE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 5-(1H-indol-3-yl)-1,3-thiazol-2-amine |
| InChIKey | LNABUUAHFCFGIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=CN=C(S3)N |
Computed by PubChem (NCBI)