cas: 302911-88-2 — see every product listed under this CAS number, including other names
5-(2-Chloro-5-(trifluoromethyl)phenyl)furan-2-carboxylic acid 95% (CAS 302911-88-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150474-1g |
| cas | 302911-88-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 982.25 Pln | |
| Ambeed | 10g | 1594.12 Pln | |
| Ambeed | 25g | 3118.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A150474 |
5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid (CAS 302911-88-2) is a chemical compound with the molecular formula C12H6ClF3O3 and a molecular weight of 290.62 g/mol. IUPAC name: 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid. InChIKey: SSIFVNBQAZVYCS-UHFFFAOYSA-N.
| Molecular formula | C12H6ClF3O3 |
|---|---|
| Molecular weight | 290.62 g/mol |
| IUPAC name | 5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carboxylic acid |
| InChIKey | SSIFVNBQAZVYCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C2=CC=C(O2)C(=O)O)Cl |
Computed by PubChem (NCBI)